The molecular formula of the compound is C18H19Cl2N3O4.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-[[(2R,4S)-2-(5,7-dichloro-1-benzofuran-2-yl)-4-(propoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
What is the molecular weight of the compound?
The molecular weight of the compound is 412.3 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H19Cl2N3O4/c1-2-3-24-7-14-8-25-18(27-14,9-23-11-21-10-22-23)16-5-12-4-13(19)6-15(20)17(12)26-16/h4-6,10-11,14H,2-3,7-9H2,1H3/t14-,18+/m0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is ZPKOPYYIUZGNMZ-KBXCAEBGSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCOCC1COC(O1)(CN2C=NC=N2)C3=CC4=CC(=CC(=C4O3)Cl)Cl.
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is CCCOC[C@H]1CO[C@@](O1)(CN2C=NC=N2)C3=CC4=CC(=CC(=C4O3)Cl)Cl.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.4.
How many hydrogen bond donors are in the compound?
There are 0 hydrogen bond donors in the compound.
How many hydrogen bond acceptors are in the compound?
There are 6 hydrogen bond acceptors in the compound.
※ Please kindly note that our products are for research use only.