What is the molecular formula of Urdamycin A?
The molecular formula of Urdamycin A is C43H56O17.
What is the molecular weight of Urdamycin A?
The molecular weight of Urdamycin A is 844.9 g/mol.
What is the IUPAC name of Urdamycin A?
The IUPAC name of Urdamycin A is (3R,4aR,12bS)-9-[(2R,4R,5R,6R)-4-[(2S,5S,6S)-5-[(2S,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyloxan-2-yl]-3,4a,8-trihydroxy-12b-[(2S,5S,6S)-5-hydroxy-6-methyloxan-2-yl]oxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione.
What are some synonyms of Urdamycin A?
Some synonyms of Urdamycin A include Kerriamycin B and 98474-21-6.
In which organisms can Urdamycin A be found?
Urdamycin A can be found in Streptomyces fradiae, Streptomyces griseus, and Streptomyces violaceolatus.
What is the Canonical SMILES representation of Urdamycin A?
The Canonical SMILES representation of Urdamycin A is CC1C(CCC(O1)OC23C(=O)CC(CC2(C=CC4=C3C(=O)C5=C(C4=O)C(=C(C=C5)C6CC(C(C(O6)C)O)OC7CCC(C(O7)C)OC8CC(C(C(O8)C)O)O)O)(C)O)O)O.
What is the InChIKey of Urdamycin A?
The InChIKey of Urdamycin A is FJSYXNOFZQFOAN-FXPMUEKOSA-N.
What is the ChEMBL ID of Urdamycin A?
The ChEMBL ID of Urdamycin A is CHEMBL4858734.
How many hydrogen bond donor counts does Urdamycin A have?
Urdamycin A has 7 hydrogen bond donor counts.
What is the XLogP3-AA value of Urdamycin A?
The XLogP3-AA value of Urdamycin A is 0.4.