What is the molecular formula of Pyrazosulfuron?
The molecular formula of Pyrazosulfuron is C12H14N6O7S.
What are the synonyms of Pyrazosulfuron?
The synonyms of Pyrazosulfuron are Pyrazosulfuron, 98389-04-9, XRH8L723X7, and CHEBI:82037.
What is the molecular weight of Pyrazosulfuron?
The molecular weight of Pyrazosulfuron is 386.34 g/mol.
When was Pyrazosulfuron created?
Pyrazosulfuron was created on August 8, 2005.
What is the IUPAC name of Pyrazosulfuron?
The IUPAC name of Pyrazosulfuron is 5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazole-4-carboxylic acid.
What is the InChI code of Pyrazosulfuron?
The InChI code of Pyrazosulfuron is InChI=1S/C12H14N6O7S/c1-18-9(6(5-13-18)10(19)20)26(22,23)17-12(21)16-11-14-7(24-2)4-8(15-11)25-3/h4-5H,1-3H3,(H,19,20)(H2,14,15,16,17,21).
What is the InChIKey of Pyrazosulfuron?
The InChIKey of Pyrazosulfuron is VXMNDQDDWDDKOQ-UHFFFAOYSA-N.
What is the canonical SMILES of Pyrazosulfuron?
The canonical SMILES of Pyrazosulfuron is CN1C(=C(C=N1)C(=O)O)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC.
What is the CAS number of Pyrazosulfuron?
The CAS number of Pyrazosulfuron is 98389-04-9.
Download
