What is the molecular formula of 3,5-Diaminobenzhydrazide?
The molecular formula of 3,5-Diaminobenzhydrazide is C7H10N4O.
What is the molecular weight of 3,5-Diaminobenzhydrazide?
The molecular weight of 3,5-Diaminobenzhydrazide is 166.18 g/mol.
What is the IUPAC name of 3,5-Diaminobenzhydrazide?
The IUPAC name of 3,5-Diaminobenzhydrazide is 3,5-diaminobenzohydrazide.
What is the InChI of 3,5-Diaminobenzhydrazide?
The InChI of 3,5-Diaminobenzhydrazide is InChI=1S/C7H10N4O/c8-5-1-4(7(12)11-10)2-6(9)3-5/h1-3H,8-10H2,(H,11,12).
What is the InChIKey of 3,5-Diaminobenzhydrazide?
The InChIKey of 3,5-Diaminobenzhydrazide is SXCOUZHOCZHPIZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Diaminobenzhydrazide?
The canonical SMILES of 3,5-Diaminobenzhydrazide is C1=C(C=C(C=C1N)N)C(=O)NN.
What is the CAS number of 3,5-Diaminobenzhydrazide?
The CAS number of 3,5-Diaminobenzhydrazide is 98335-17-2.
What is the DSSTox Substance ID of 3,5-Diaminobenzhydrazide?
The DSSTox Substance ID of 3,5-Diaminobenzhydrazide is DTXSID10342847.
Is 3,5-Diaminobenzhydrazide a canonicalized compound?
Yes, 3,5-Diaminobenzhydrazide is a canonicalized compound.