What is the chemical formula of 6-bromo-5-nitroquinoline?
The chemical formula of 6-bromo-5-nitroquinoline is C9H5BrN2O2.
When was 6-bromo-5-nitroquinoline created and modified?
6-bromo-5-nitroquinoline was created on 2005-03-26 and modified on 2023-12-30.
What is the IUPAC name of 6-bromo-5-nitroquinoline?
The IUPAC name of 6-bromo-5-nitroquinoline is 6-bromo-5-nitroquinoline.
What is the molecular weight of 6-bromo-5-nitroquinoline?
The molecular weight of 6-bromo-5-nitroquinoline is 253.05 g/mol.
What is the InChI of 6-bromo-5-nitroquinoline?
The InChI of 6-bromo-5-nitroquinoline is InChI=1S/C9H5BrN2O2/c10-7-3-4-8-6(2-1-5-11-8)9(7)12(13)14/h1-5H.
What is the InChIKey of 6-bromo-5-nitroquinoline?
The InChIKey of 6-bromo-5-nitroquinoline is ISBMTVQQECNRQY-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 6-bromo-5-nitroquinoline have?
6-bromo-5-nitroquinoline has 0 hydrogen bond donor counts.
What is the topological polar surface area of 6-bromo-5-nitroquinoline?
The topological polar surface area of 6-bromo-5-nitroquinoline is 58.7 Ų.
Is 6-bromo-5-nitroquinoline a canonicalized compound?
Yes, 6-bromo-5-nitroquinoline is a canonicalized compound.
How many covalently-bonded unit counts does 6-bromo-5-nitroquinoline have?
6-bromo-5-nitroquinoline has a covalently-bonded unit count of 1.