What is the molecular formula of Clopenthixol?
The molecular formula of Clopenthixol is C22H25ClN2OS.
What is the molecular weight of Clopenthixol?
The molecular weight of Clopenthixol is 401.0 g/mol.
What are some synonyms of Clopenthixol?
Some synonyms of Clopenthixol are trans-Clopenthixol, Chlorpenthixol, and Clopentixol.
What is the IUPAC name of Clopenthixol?
The IUPAC name of Clopenthixol is 2-[4-[(3E)-3-(2-chlorothioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol.
What is the InChIKey of Clopenthixol?
The InChIKey of Clopenthixol is WFPIAZLQTJBIFN-BLLMUTORSA-N.
What is the canonical SMILES of Clopenthixol?
The canonical SMILES of Clopenthixol is C1CN(CCN1CCC=C2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO.
What is the CAS number of Clopenthixol?
The CAS number of Clopenthixol is 53772-84-2.
What is the ChEMBL ID of Clopenthixol?
The ChEMBL ID of Clopenthixol is CHEMBL87385.
What is the XLogP3 value of Clopenthixol?
The XLogP3 value of Clopenthixol is 4.3.
What is the topological polar surface area of Clopenthixol?
The topological polar surface area of Clopenthixol is 52?2.