What is the molecular formula of 2-Methylbenzyl alcohol?
The molecular formula of 2-Methylbenzyl alcohol is C8H10O.
What is the molecular weight of 2-Methylbenzyl alcohol?
The molecular weight of 2-Methylbenzyl alcohol is 122.16 g/mol.
What is the IUPAC name of 2-Methylbenzyl alcohol?
The IUPAC name of 2-Methylbenzyl alcohol is (2-methylphenyl)methanol.
What is the InChI of 2-Methylbenzyl alcohol?
The InChI of 2-Methylbenzyl alcohol is InChI=1S/C8H10O/c1-7-4-2-3-5-8(7)6-9/h2-5,9H,6H2,1H3.
What is the InChIKey of 2-Methylbenzyl alcohol?
The InChIKey of 2-Methylbenzyl alcohol is XPNGNIFUDRPBFJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methylbenzyl alcohol?
The canonical SMILES of 2-Methylbenzyl alcohol is CC1=CC=CC=C1CO.
What is the CAS number of 2-Methylbenzyl alcohol?
The CAS number of 2-Methylbenzyl alcohol is 89-95-2.
What is the XLogP3 value of 2-Methylbenzyl alcohol?
The XLogP3 value of 2-Methylbenzyl alcohol is 1.6.
How many hydrogen bond donor counts does 2-Methylbenzyl alcohol have?
2-Methylbenzyl alcohol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Methylbenzyl alcohol have?
2-Methylbenzyl alcohol has 1 hydrogen bond acceptor count.