What is the molecular formula of sulfanilyl fluoride?
The molecular formula of sulfanilyl fluoride is C6H6FNO2S.
What is the molecular weight of sulfanilyl fluoride?
The molecular weight of sulfanilyl fluoride is 175.18 g/mol.
What is the IUPAC name of sulfanilyl fluoride?
The IUPAC name of sulfanilyl fluoride is 4-aminobenzenesulfonyl fluoride.
What is the InChI of sulfanilyl fluoride?
The InChI of sulfanilyl fluoride is InChI=1S/C6H6FNO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1-4H,8H2.
What is the InChIKey of sulfanilyl fluoride?
The InChIKey of sulfanilyl fluoride is BPUKPIBWYZWYQV-UHFFFAOYSA-N.
What is the canonical SMILES of sulfanilyl fluoride?
The canonical SMILES of sulfanilyl fluoride is C1=CC(=CC=C1N)S(=O)(=O)F.
What is the CAS number of sulfanilyl fluoride?
The CAS number of sulfanilyl fluoride is 98-62-4.
What is the EC number of sulfanilyl fluoride?
The EC number of sulfanilyl fluoride is 202-687-4.
What is the UNII of sulfanilyl fluoride?
The UNII of sulfanilyl fluoride is VQ58NDG0Q4.
What is the molecular weight and XLogP3 value of sulfanilyl fluoride?
The molecular weight of sulfanilyl fluoride is 175.18 g/mol, and the XLogP3 value is 0.4.