What is the molecular formula of Pipsyl chloride?
The molecular formula of Pipsyl chloride is C6H4ClIO2S.
What is the molecular weight of Pipsyl chloride?
The molecular weight of Pipsyl chloride is 302.52 g/mol.
What is the IUPAC name of Pipsyl chloride?
The IUPAC name of Pipsyl chloride is 4-iodobenzenesulfonyl chloride.
What is the InChI of Pipsyl chloride?
The InChI of Pipsyl chloride is InChI=1S/C6H4ClIO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1-4H.
What is the InChIKey of Pipsyl chloride?
The InChIKey of Pipsyl chloride is POXFXTSTVWDWIR-UHFFFAOYSA-N.
What is the canonical SMILES of Pipsyl chloride?
The canonical SMILES of Pipsyl chloride is C1=CC(=CC=C1S(=O)(=O)Cl)I.
What is the CAS number of Pipsyl chloride?
The CAS number of Pipsyl chloride is 98-61-3.
What is the European Community (EC) Number of Pipsyl chloride?
The European Community (EC) Number of Pipsyl chloride is 202-686-9.
What is the UNII of Pipsyl chloride?
The UNII of Pipsyl chloride is MVL274EZOG.
Is Pipsyl chloride a canonicalized compound?
Yes, Pipsyl chloride is a canonicalized compound.