What is the molecular formula of 2,3-Dibromopentane?
The molecular formula of 2,3-Dibromopentane is C5H10Br2.
What is the molecular weight of 2,3-Dibromopentane?
The molecular weight of 2,3-Dibromopentane is 229.94 g/mol.
When was 2,3-Dibromopentane created in PubChem?
2,3-Dibromopentane was created in PubChem on March 26, 2005.
What is the IUPAC name of 2,3-Dibromopentane?
The IUPAC name of 2,3-Dibromopentane is 2,3-dibromopentane.
What is the InChI code of 2,3-Dibromopentane?
The InChI code of 2,3-Dibromopentane is InChI=1S/C5H10Br2/c1-3-5(7)4(2)6/h4-5H,3H2,1-2H3.
What is the InChIKey of 2,3-Dibromopentane?
The InChIKey of 2,3-Dibromopentane is LWBRXRHBXMVUEX-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dibromopentane?
The canonical SMILES of 2,3-Dibromopentane is CCC(C(C)Br)Br.
What is the CAS number of 2,3-Dibromopentane?
The CAS number of 2,3-Dibromopentane is 5398-25-4.
What is the XLogP3-AA value of 2,3-Dibromopentane?
The XLogP3-AA value of 2,3-Dibromopentane is 3.1.
How many hydrogen bond donor and acceptor counts does 2,3-Dibromopentane have?
2,3-Dibromopentane has zero hydrogen bond donor and acceptor counts.