The molecular formula of the compound is C20H16N2O.
What are the synonyms of the compound?
The synonyms of the compound include 97993-15-2, Fluorene-2-azo-2-methyl-4-hydroxybenzene, Fluorene-2-azo-2'-methyl-4'-hydroxybenzene, 4-(2-Fluorenylazo)-m-cresol, and NoName_1555.
What is the molecular weight of the compound?
The molecular weight of the compound is 300.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(9H-fluoren-2-yldiazenyl)-3-methylphenol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C20H16N2O/c1-13-10-17(23)7-9-20(13)22-21-16-6-8-19-15(12-16)11-14-4-2-3-5-18(14)19/h2-10,12,23H,11H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is YHELYTRELJRMBS-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C(C=CC(=C1)O)N=NC2=CC3=C(C=C2)C4=CC=CC=C4C3.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 5.3.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.
Download
![(4-Chloro-1-methyl-1H-pyrrolo[3,2-c]pyridin-3-yl)methanol ,97%](https://resource.alfa-chemistry.com/structure/97989-54-3.gif)
