What is the molecular formula of 3-Bromocinnamaldehyde?
The molecular formula of 3-Bromocinnamaldehyde is C9H7BrO.
What are the synonyms of 3-Bromocinnamaldehyde?
The synonyms of 3-Bromocinnamaldehyde include 3-(3-Bromophenyl)acrylaldehyde, (E)-3-(3-Bromophenyl)acrylaldehyde, 97985-66-5, and 15185-59-8.
What is the molecular weight of 3-Bromocinnamaldehyde?
The molecular weight of 3-Bromocinnamaldehyde is 211.05 g/mol.
What is the IUPAC name of 3-Bromocinnamaldehyde?
The IUPAC name of 3-Bromocinnamaldehyde is (E)-3-(3-bromophenyl)prop-2-enal.
What is the InChI of 3-Bromocinnamaldehyde?
The InChI of 3-Bromocinnamaldehyde is InChI=1S/C9H7BrO/c10-9-5-1-3-8(7-9)4-2-6-11/h1-7H/b4-2+.
What is the InChIKey of 3-Bromocinnamaldehyde?
The InChIKey of 3-Bromocinnamaldehyde is QICJGJJHIQBWJR-DUXPYHPUSA-N.
What is the canonical SMILES of 3-Bromocinnamaldehyde?
The canonical SMILES of 3-Bromocinnamaldehyde is C1=CC(=CC(=C1)Br)C=CC=O.
What is the isomeric SMILES of 3-Bromocinnamaldehyde?
The isomeric SMILES of 3-Bromocinnamaldehyde is C1=CC(=CC(=C1)Br)/C=C/C=O.
What is the XLogP3-AA value of 3-Bromocinnamaldehyde?
The XLogP3-AA value of 3-Bromocinnamaldehyde is 2.5.
What is the topological polar surface area of 3-Bromocinnamaldehyde?
The topological polar surface area of 3-Bromocinnamaldehyde is 17.1?2.