What is the PubChem CID of dithiopyr?
The PubChem CID of dithiopyr is 91757.
What is the molecular formula of dithiopyr?
The molecular formula of dithiopyr is C15H16F5NO2S2.
What is the molecular weight of dithiopyr?
The molecular weight of dithiopyr is 401.4 g/mol.
What are the synonyms of dithiopyr?
The synonyms of dithiopyr include Dimension, Dithiopyr [ISO], and 2TXF17HAV1.
What is the IUPAC name of dithiopyr?
The IUPAC name of dithiopyr is 3-S,5-S-dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioate.
What is the InChIKey of dithiopyr?
The InChIKey of dithiopyr is YUBJPYNSGLJZPQ-UHFFFAOYSA-N.
What is the Canonical SMILES of dithiopyr?
The Canonical SMILES of dithiopyr is CC(C)CC1=C(C(=NC(=C1C(=O)SC)C(F)(F)F)C(F)F)C(=O)SC.
What is the CAS number of dithiopyr?
The CAS number of dithiopyr is 97886-45-8.
What is the XLogP3-AA value of dithiopyr?
The XLogP3-AA value of dithiopyr is 4.8.
What is the hydrogen bond acceptor count of dithiopyr?
The hydrogen bond acceptor count of dithiopyr is 10.