What is the molecular formula of Cumene-D12?
The molecular formula of Cumene-D12 is C9H12.
When was Cumene-D12 created and last modified?
Cumene-D12 was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Cumene-D12?
The IUPAC name of Cumene-D12 is 1,2,3,4,5-pentadeuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene.
What is the molecular weight of Cumene-D12?
The molecular weight of Cumene-D12 is 132.26 g/mol.
What is the Canonical SMILES of Cumene-D12?
The Canonical SMILES of Cumene-D12 is CC(C)C1=CC=CC=C1.
What is the InChIKey of Cumene-D12?
The InChIKey of Cumene-D12 is RWGFKTVRMDUZSP-CLWNCLMISA-N.
What is the Isomeric SMILES of Cumene-D12?
The Isomeric SMILES of Cumene-D12 is [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H].
What is the European Community (EC) Number of Cumene-D12?
The European Community (EC) Number of Cumene-D12 is 685-463-2.
What is the XLogP3 value of Cumene-D12?
The XLogP3 value of Cumene-D12 is 3.7.
How many defined atom stereocenters does Cumene-D12 have?
Cumene-D12 has 0 defined atom stereocenters.
Download
