What is the molecular formula of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The molecular formula of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate is C10H16O4.
What are the synonyms for Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The synonyms for Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate are SCHEMBL12987462 and XGRJGTBLDJAHTL-HTQZYQBOSA-N.
When was Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate created?
Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate was created on July 12, 2012.
What is the IUPAC name of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The IUPAC name of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate is (1R,2R)-2-ethoxycarbonylcyclohexane-1-carboxylic acid.
What is the InChI of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The InChI of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate is InChI=1S/C10H16O4/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12/h7-8H,2-6H2,1H3,(H,11,12)/t7-,8-/m1/s1.
What is the InChIKey of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The InChIKey of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate is XGRJGTBLDJAHTL-HTQZYQBOSA-N.
What is the molecular weight of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate?
The molecular weight of Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate is 200.23 g/mol.
How many hydrogen bond donor counts does Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate have?
Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate have?
Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate have?
Ethyl hydrogen trans-cyclohexane-1,2-dicarboxylate has 4 rotatable bond counts.
※ Please kindly note that our products are for research use only.