The molecular formula of the compound is C16H23ClO4.
What are the synonyms of the compound?
The synonyms of the compound are 23359-62-8, 2-butoxyethyl 2-(4-chloro-2-methylphenoxy)propanoate, 2-Butoxyethyl 2-(4-chloro-2-methylphenoxy)propionate, and more.
What is the molecular weight of the compound?
The molecular weight of the compound is 314.80 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-butoxyethyl 2-(4-chloro-2-methylphenoxy)propanoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H23ClO4/c1-4-5-8-19-9-10-20-16(18)13(3)21-15-7-6-14(17)11-12(15)2/h6-7,11,13H,4-5,8-10H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is GWFGUAFFJVHZKY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCCOCCOC(=O)C(C)OC1=C(C=C(C=C1)Cl)C.
What is the CAS number of the compound?
The CAS number of the compound is 23359-62-8.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 4.6.
※ Please kindly note that our products are for research use only.