What is the molecular formula of calcium glubionate?
The molecular formula of calcium glubionate is C18H32CaO19.
What is the synonyms of calcium glubionate?
The synonyms of calcium glubionate are Calcium D-gluconate lactobionate calcium and (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
What is the molecular weight of calcium glubionate?
The molecular weight of calcium glubionate is 592.5 g/mol.
What are the component compounds of calcium glubionate?
The component compounds of calcium glubionate are Lactobionic acid (CID 7314), Calcium (CID 5460341), and Gluconic Acid (CID 10690).
What is the IUPAC name of calcium glubionate?
The IUPAC name of calcium glubionate is calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate.
What is the InChI of calcium glubionate?
The InChI of calcium glubionate is InChI=1S/C12H22O12.C6H12O7.Ca/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-10,12-20H,1-2H2,(H,21,22);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3-,4-,5+,6+,7-,8-,9-,10-,12+;2-,3-,4+,5-;/m11./s1.
What is the Canonical SMILES of calcium glubionate?
The Canonical SMILES of calcium glubionate is C(C1C(C(C(C(O1)OC(C(CO)O)C(C(C(=O)[O-])O)O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2].
What is the CAS number of calcium glubionate?
The CAS number of calcium glubionate is 97635-31-9.
What is the hydrogen bond acceptor count of calcium glubionate?
The hydrogen bond acceptor count of calcium glubionate is 19.