What is the molecular formula of 7432-S-trans sodium salt?
The molecular formula of 7432-S-trans sodium salt is C15H12N4Na2O6S2.
Can you provide some synonyms for 7432-S-trans sodium salt?
Some synonyms for 7432-S-trans sodium salt include S 7432 sodium salt, trans-7432 sodium, and 5-Thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid.
What is the molecular weight of 7432-S-trans sodium salt?
The molecular weight of 7432-S-trans sodium salt is 454.4 g/mol.
What is the IUPAC name of 7432-S-trans sodium salt?
The IUPAC name of 7432-S-trans sodium salt is disodium;(6R,7R)-7-[[(E)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxylatobut-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
What are the InChI and InChIKey identifiers for 7432-S-trans sodium salt?
The InChI for 7432-S-trans sodium salt is InChI=1S/C15H14N4O6S2.2Na/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19;;/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25);;/q;2*+1/p-2/b6-1+;;/t10-,13-;;/m1../s1, and the InChIKey is BZEMMXYCXPPDCE-BATFEWGOSA-L.
How many hydrogen bond donor counts does 7432-S-trans sodium salt have?
7432-S-trans sodium salt has 2 hydrogen bond donor counts.
What is the hydrogen bond acceptor count of 7432-S-trans sodium salt?
7432-S-trans sodium salt has 10 hydrogen bond acceptor counts.
How many rotatable bond counts does 7432-S-trans sodium salt have?
7432-S-trans sodium salt has 4 rotatable bond counts.
What is the exact mass and the monoisotopic mass of 7432-S-trans sodium salt?
The exact mass and monoisotopic mass of 7432-S-trans sodium salt are both 453.99936503 g/mol.
Does 7432-S-trans sodium salt contain any defined atom stereocenters?
Yes, 7432-S-trans sodium salt contains 2 defined atom stereocenters.