What is the molecular formula of Chembrdg-bb 5561898?
The molecular formula of Chembrdg-bb 5561898 is C12H19NO2.
What are the synonyms for Chembrdg-bb 5561898?
The synonyms for Chembrdg-bb 5561898 are 97294-81-0, (3,5-DIMETHOXYBENZYL)ISOPROPYLAMINE, N-(3,5-dimethoxybenzyl)propan-2-amine, CHEMBRDG-BB 5561898, and N-[(3,5-dimethoxyphenyl)methyl]propan-2-amine.
What is the molecular weight of Chembrdg-bb 5561898?
The molecular weight of Chembrdg-bb 5561898 is 209.28 g/mol.
When was Chembrdg-bb 5561898 created?
Chembrdg-bb 5561898 was created on 2005-07-08.
When was Chembrdg-bb 5561898 last modified?
Chembrdg-bb 5561898 was last modified on 2023-12-30.
What is the IUPAC name of Chembrdg-bb 5561898?
The IUPAC name of Chembrdg-bb 5561898 is N-[(3,5-dimethoxyphenyl)methyl]propan-2-amine.
What is the InChI of Chembrdg-bb 5561898?
The InChI of Chembrdg-bb 5561898 is InChI=1S/C12H19NO2/c1-9(2)13-8-10-5-11(14-3)7-12(6-10)15-4/h5-7,9,13H,8H2,1-4H3.
What is the InChIKey of Chembrdg-bb 5561898?
The InChIKey of Chembrdg-bb 5561898 is PDSDLLSCLBVTKD-UHFFFAOYSA-N.
What is the Canonical SMILES of Chembrdg-bb 5561898?
The Canonical SMILES of Chembrdg-bb 5561898 is CC(C)NCC1=CC(=CC(=C1)OC)OC.
What is the XLogP3-AA value of Chembrdg-bb 5561898?
The XLogP3-AA value of Chembrdg-bb 5561898 is 2.