What is the molecular formula of 2-PHENYL-D5-PROPANE?
The molecular formula of 2-PHENYL-D5-PROPANE is C9H12.
What is the molecular weight of 2-PHENYL-D5-PROPANE?
The molecular weight of 2-PHENYL-D5-PROPANE is 125.22 g/mol.
What is the IUPAC name of 2-PHENYL-D5-PROPANE?
The IUPAC name of 2-PHENYL-D5-PROPANE is 1,2,3,4,5-pentadeuterio-6-propan-2-ylbenzene.
What is the InChI of 2-PHENYL-D5-PROPANE?
The InChI of 2-PHENYL-D5-PROPANE is InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3/i3D,4D,5D,6D,7D.
What is the InChIKey of 2-PHENYL-D5-PROPANE?
The InChIKey of 2-PHENYL-D5-PROPANE is RWGFKTVRMDUZSP-DKFMXDSJSA-N.
What is the canonical SMILES of 2-PHENYL-D5-PROPANE?
The canonical SMILES of 2-PHENYL-D5-PROPANE is CC(C)C1=CC=CC=C1.
What is the isomeric SMILES of 2-PHENYL-D5-PROPANE?
The isomeric SMILES of 2-PHENYL-D5-PROPANE is [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)C)[2H])[2H].
What is the XLogP3 value of 2-PHENYL-D5-PROPANE?
The XLogP3 value of 2-PHENYL-D5-PROPANE is 3.7.
How many rotatable bonds are there in 2-PHENYL-D5-PROPANE?
There is 1 rotatable bond in 2-PHENYL-D5-PROPANE.
Is 2-PHENYL-D5-PROPANE a canonicalized compound?
Yes, 2-PHENYL-D5-PROPANE is a canonicalized compound.