What is the PubChem CID of Fast garnet gbc base?
The PubChem CID of Fast garnet gbc base is 7340.
What is the molecular formula of Fast garnet gbc base?
The molecular formula of Fast garnet gbc base is C14H15N3.
What is the molecular weight of Fast garnet gbc base?
The molecular weight of Fast garnet gbc base is 225.29 g/mol.
What are some synonyms of Fast garnet gbc base?
Some synonyms of Fast garnet gbc base are o-Aminoazotoluene, Solvent Yellow 3, and 2-Aminoazotoluene.
What is the IUPAC name of Fast garnet gbc base?
The IUPAC name of Fast garnet gbc base is 2-methyl-4-[(2-methylphenyl)diazenyl]aniline.
What is the InChI of Fast garnet gbc base?
The InChI of Fast garnet gbc base is InChI=1S/C14H15N3/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12/h3-9H,15H2,1-2H3.
What is the InChIKey of Fast garnet gbc base?
The InChIKey of Fast garnet gbc base is PFRYFZZSECNQOL-UHFFFAOYSA-N.
What is the canonical SMILES of Fast garnet gbc base?
The canonical SMILES of Fast garnet gbc base is CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C.
What is the CAS number of Fast garnet gbc base?
The CAS number of Fast garnet gbc base is 97-56-3.
What is the ChEMBL ID of Fast garnet gbc base?
The ChEMBL ID of Fast garnet gbc base is CHEMBL83552.