What is the molecular formula of 1,3-Di-O-tolylguanidine?
The molecular formula of 1,3-Di-O-tolylguanidine is C15H17N3.
What is the molecular weight of 1,3-Di-O-tolylguanidine?
The molecular weight of 1,3-Di-O-tolylguanidine is 239.32 g/mol.
What is the IUPAC name of 1,3-Di-O-tolylguanidine?
The IUPAC name of 1,3-Di-O-tolylguanidine is 1,2-bis(2-methylphenyl)guanidine.
What is the InChI key of 1,3-Di-O-tolylguanidine?
The InChI key of 1,3-Di-O-tolylguanidine is OPNUROKCUBTKLF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1,3-Di-O-tolylguanidine?
The canonical SMILES representation of 1,3-Di-O-tolylguanidine is CC1=CC=CC=C1NC(=NC2=CC=CC=C2C)N.
What is the CAS number of 1,3-Di-O-tolylguanidine?
The CAS number of 1,3-Di-O-tolylguanidine is 97-39-2.
What is the hydrochloride form of 1,3-Di-O-tolylguanidine's related CAS number?
The hydrochloride form of 1,3-Di-O-tolylguanidine's related CAS number is 41130-39-6.
What is the UNII of 1,3-Di-O-tolylguanidine?
The UNII of 1,3-Di-O-tolylguanidine is LL2P01I17O.
How many hydrogen bond donor counts does 1,3-Di-O-tolylguanidine have?
1,3-Di-O-tolylguanidine has 2 hydrogen bond donor counts.
How many rotatable bond counts does 1,3-Di-O-tolylguanidine have?
1,3-Di-O-tolylguanidine has 3 rotatable bond counts.