What is the molecular formula of the chemical with PubChem CID 222464?
The molecular formula is C12H15NO2.
What are some synonyms for the chemical with PubChem CID 222464?
Some synonyms include N-(2,4-Dimethylphenyl)-3-oxobutanamide and Acetoacet-m-xylidide.
When was the chemical with PubChem CID 222464 first created in PubChem?
It was first created on March 26, 2005.
What is the InChIKey for the chemical with PubChem CID 222464?
The InChIKey is HGVIAKXYAZRSEG-UHFFFAOYSA-N.
What is the molecular weight of the chemical with PubChem CID 222464?
The molecular weight is 205.25 g/mol.
What is the Canonical SMILES for the chemical with PubChem CID 222464?
The Canonical SMILES is CC1=CC(=C(C=C1)NC(=O)CC(=O)C)C.
What is the CAS number for the chemical with PubChem CID 222464?
The CAS number is 97-36-9.
What is the topological polar surface area of the chemical with PubChem CID 222464?
The topological polar surface area is 46.2 Ų.
What is the XLogP3 value of the chemical with PubChem CID 222464?
The XLogP3 value is 1.9.
How many hydrogen bond acceptor counts does the chemical with PubChem CID 222464 have?
It has 2 hydrogen bond acceptor counts.