What is the PubChem CID of Butinoline?
PubChem CID 68943
What is the molecular formula of Butinoline?
The molecular formula of Butinoline is C20H21NO.
What is the molecular weight of Butinoline?
The molecular weight of Butinoline is 291.4 g/mol.
When was Butinoline created in PubChem?
Butinoline was created in PubChem on March 27, 2005.
What is the IUPAC name of Butinoline?
The IUPAC name of Butinoline is 1,1-diphenyl-4-pyrrolidin-1-ylbut-2-yn-1-ol.
What is the InChIKey of Butinoline?
The InChIKey of Butinoline is LWPXJPFOEPMIRG-UHFFFAOYSA-N.
What is the canonical SMILES of Butinoline?
The canonical SMILES of Butinoline is C1CCN(C1)CC#CC(C2=CC=CC=C2)(C3=CC=CC=C3)O.
What is the CAS number of Butinoline?
The CAS number of Butinoline is 968-63-8.
What is the XLogP3-AA value of Butinoline?
The XLogP3-AA value of Butinoline is 3.3.
What is the hydrogen bond donor count of Butinoline?
The hydrogen bond donor count of Butinoline is 1.