What is the molecular formula of 4-iodo-1-tritylimidazole?
The molecular formula of 4-iodo-1-tritylimidazole is C22H17IN2.
What is the molecular weight of 4-iodo-1-tritylimidazole?
The molecular weight of 4-iodo-1-tritylimidazole is 436.3 g/mol.
What is the IUPAC name of 4-iodo-1-tritylimidazole?
The IUPAC name of 4-iodo-1-tritylimidazole is 4-iodo-1-tritylimidazole.
What is the InChI of 4-iodo-1-tritylimidazole?
The InChI of 4-iodo-1-tritylimidazole is InChI=1S/C22H17IN2/c23-21-16-25(17-24-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H.
What is the InChIKey of 4-iodo-1-tritylimidazole?
The InChIKey of 4-iodo-1-tritylimidazole is DXJZJYPLPZEYBH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-iodo-1-tritylimidazole?
The canonical SMILES of 4-iodo-1-tritylimidazole is C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)I.
What is the CAS number of 4-iodo-1-tritylimidazole?
The CAS number of 4-iodo-1-tritylimidazole is 96797-15-8.
What is the XLogP3-AA value of 4-iodo-1-tritylimidazole?
The XLogP3-AA value of 4-iodo-1-tritylimidazole is 5.5.
Is 4-iodo-1-tritylimidazole a canonicalized compound?
Yes, 4-iodo-1-tritylimidazole is a canonicalized compound.
What is the European Community (EC) number of 4-iodo-1-tritylimidazole?
The European Community (EC) number of 4-iodo-1-tritylimidazole is 673-686-8.
What is the DSSTox Substance ID of 4-iodo-1-tritylimidazole?
The DSSTox Substance ID of 4-iodo-1-tritylimidazole is DTXSID50347139.