What is the molecular formula of Chembrdg-bb 4021965?
The molecular formula is C13H14O3.
What is the molecular weight of Chembrdg-bb 4021965?
The molecular weight is 218.25 g/mol.
What is the IUPAC name of Chembrdg-bb 4021965?
The IUPAC name is 2,4-bis(prop-2-enoxy)benzaldehyde.
What is the InChI of Chembrdg-bb 4021965?
The InChI is InChI=1S/C13H14O3/c1-3-7-15-12-6-5-11(10-14)13(9-12)16-8-4-2/h3-6,9-10H,1-2,7-8H2.
What is the InChIKey of Chembrdg-bb 4021965?
The InChIKey is GACDJVALBBJGQY-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4021965?
The canonical SMILES is C=CCOC1=CC(=C(C=C1)C=O)OCC=C.
What is the CAS number of Chembrdg-bb 4021965?
The CAS number is 96601-10-4.
What is the hydrogen bond donor count of Chembrdg-bb 4021965?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of Chembrdg-bb 4021965?
The hydrogen bond acceptor count is 3.
Is Chembrdg-bb 4021965 a canonicalized compound?
Yes, Chembrdg-bb 4021965 is a canonicalized compound.