What is the molecular formula of Aurora ka-6200?
The molecular formula of Aurora ka-6200 is C13H7ClN4.
When was Aurora ka-6200 created and last modified?
Aurora ka-6200 was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Aurora ka-6200?
The IUPAC name of Aurora ka-6200 is 2-amino-6-chloro-4-phenylpyridine-3,5-dicarbonitrile.
What is the molecular weight of Aurora ka-6200?
The molecular weight of Aurora ka-6200 is 254.67 g/mol.
What is the Canonical SMILES representation of Aurora ka-6200?
The Canonical SMILES representation of Aurora ka-6200 is C1=CC=C(C=C1)C2=C(C(=NC(=C2C#N)Cl)N)C#N.
How many Hydrogen Bond Donors does Aurora ka-6200 have?
Aurora ka-6200 has 1 Hydrogen Bond Donor.
What is the Heavy Atom Count of Aurora ka-6200?
The Heavy Atom Count of Aurora ka-6200 is 18.
Is Aurora ka-6200 a Covalently-Bonded unit?
Yes, Aurora ka-6200 is a Covalently-Bonded unit.
What is the Formal Charge of Aurora ka-6200?
The Formal Charge of Aurora ka-6200 is 0.
How many Rotatable Bond Counts does Aurora ka-6200 have?
Aurora ka-6200 has 1 Rotatable Bond Count.