What is the molecular formula of 3-Bromo-5-chloroaniline?
The molecular formula of 3-Bromo-5-chloroaniline is C6H5BrClN.
What is the molecular weight of 3-Bromo-5-chloroaniline?
The molecular weight of 3-Bromo-5-chloroaniline is 206.47 g/mol.
What is the IUPAC Name of 3-Bromo-5-chloroaniline?
The IUPAC Name of 3-Bromo-5-chloroaniline is 3-bromo-5-chloroaniline.
What is the InChI of 3-Bromo-5-chloroaniline?
The InChI of 3-Bromo-5-chloroaniline is InChI=1S/C6H5BrClN/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2.
What is the InChIKey of 3-Bromo-5-chloroaniline?
The InChIKey of 3-Bromo-5-chloroaniline is YYBRLVWWPRAQDX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chloroaniline?
The canonical SMILES of 3-Bromo-5-chloroaniline is C1=C(C=C(C=C1Cl)Br)N.
What is the CAS number of 3-Bromo-5-chloroaniline?
The CAS number of 3-Bromo-5-chloroaniline is 38762-41-3.
What is the European Community (EC) number of 3-Bromo-5-chloroaniline?
The European Community (EC) number of 3-Bromo-5-chloroaniline is 696-451-1.
What is the XLogP3 value of 3-Bromo-5-chloroaniline?
The XLogP3 value of 3-Bromo-5-chloroaniline is 3.
Is 3-Bromo-5-chloroaniline a canonicalized compound?
Yes, 3-Bromo-5-chloroaniline is a canonicalized compound.