What is the molecular formula of Decyl nonyl phthalate?
The molecular formula of Decyl nonyl phthalate is C27H44O4.
When was the structure of Decyl nonyl phthalate created?
The structure of Decyl nonyl phthalate was created on August 8, 2005.
What is the molecular weight of Decyl nonyl phthalate?
The molecular weight of Decyl nonyl phthalate is 432.6 g/mol.
What is the IUPAC Name of Decyl nonyl phthalate?
The IUPAC Name of Decyl nonyl phthalate is 2-O-decyl 1-O-nonyl benzene-1,2-dicarboxylate.
What is the Canonical SMILES of Decyl nonyl phthalate?
The Canonical SMILES of Decyl nonyl phthalate is CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC.
What is the InChIKey of Decyl nonyl phthalate?
The InChIKey of Decyl nonyl phthalate is NSZKIDSVINDASL-UHFFFAOYSA-N.
What is the CAS number of Decyl nonyl phthalate?
The CAS number of Decyl nonyl phthalate is 96507-76-5.
What is the XLogP3 value of Decyl nonyl phthalate?
The XLogP3 value of Decyl nonyl phthalate is 10.7.
How many hydrogen bond acceptor counts are there in Decyl nonyl phthalate?
There are 4 hydrogen bond acceptor counts in Decyl nonyl phthalate.
Is the compound is canonicalized for Decyl nonyl phthalate?
Yes, the compound is canonicalized for Decyl nonyl phthalate.
Download
![3-[[(5-Amino-1,3,3-trimethylcyclohexyl)methyl]amino]-2-hydroxypropyl 2-methyl-2-nonylundecanoate](https://resource.alfa-chemistry.com/structure/96507-73-2.gif)
![3-[Bis-(2-hydroxypropyl)amino]-2-hydroxypropyl 2-methyl-2-nonylundecanoate](https://resource.alfa-chemistry.com/structure/96507-75-4.gif)
