What is the PubChem CID of dicyclohexyl succinate?
PubChem CID 70405.
What is the molecular formula of dicyclohexyl succinate?
The molecular formula is C16H26O4.
What are the synonyms of dicyclohexyl succinate?
The synonyms are succinic acid dicyclohexyl ester and 965-40-2 BRN 2289111.
What is the molecular weight of dicyclohexyl succinate?
The molecular weight is 282.37 g/mol.
When was dicyclohexyl succinate created in PubChem?
It was created on March 26, 2005.
What is the IUPAC name of dicyclohexyl succinate?
The IUPAC name is dicyclohexyl butanedioate.
What is the InChI of dicyclohexyl succinate?
The InChI is InChI=1S/C16H26O4/c17-15(19-13-7-3-1-4-8-13)11-12-16(18)20-14-9-5-2-6-10-14/h13-14H,1-12H2.
What is the InChIKey of dicyclohexyl succinate?
The InChIKey is WWQSMJYMCWMODI-UHFFFAOYSA-N.
What is the canonical SMILES of dicyclohexyl succinate?
The canonical SMILES is C1CCC(CC1)OC(=O)CCC(=O)OC2CCCCC2.
How many hydrogen bond donor count does dicyclohexyl succinate have?
It has 0 hydrogen bond donor count.