The synonyms of the compound include 964-08-9, 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-on-1,1-dioxide, and 4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
What is the molecular weight of the compound?
The molecular weight is 288.32 g/mol.
When was the compound created?
The compound was created on July 30, 2006.
What is the IUPAC name of the compound?
The IUPAC name is 4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
What is the InChI of the compound?
The InChI is InChI=1S/C14H12N2O3S/c17-14-15-20(18,19)13-9-5-4-8-12(13)16(14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17).
What is the InChIKey of the compound?
The InChIKey is AXSIIVGAOIWSJU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC=C(C=C1)CN2C3=CC=CC=C3S(=O)(=O)NC2=O.
What is the CAS number of the compound?
The CAS number is 964-08-9.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.