What is the molecular formula of Dehydrofelodipine?
The molecular formula of Dehydrofelodipine is C18H17Cl2NO4.
What is the molecular weight of Dehydrofelodipine?
The molecular weight of Dehydrofelodipine is 382.2 g/mol.
What is the IUPAC name of Dehydrofelodipine?
The IUPAC name of Dehydrofelodipine is 3-O-ethyl 5-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate.
What is the InChI of Dehydrofelodipine?
The InChI of Dehydrofelodipine is InChI=1S/C18H17Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8H,5H2,1-4H3.
What is the InChIKey of Dehydrofelodipine?
The InChIKey of Dehydrofelodipine is REQRUBNOOIAHMG-UHFFFAOYSA-N.
What is the canonical SMILES of Dehydrofelodipine?
The canonical SMILES of Dehydrofelodipine is CCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl.
What is the CAS number of Dehydrofelodipine?
The CAS number of Dehydrofelodipine is 96382-71-7.
What is the EC number of Dehydrofelodipine?
The EC number of Dehydrofelodipine is 936-014-7.
What is the UNII of Dehydrofelodipine?
The UNII of Dehydrofelodipine is 1L4A1EP86I.
What is the XLogP3-AA value of Dehydrofelodipine?
The XLogP3-AA value of Dehydrofelodipine is 4.6.