What is the molecular formula of Tribendilol?
The molecular formula of Tribendilol is C18H22N4O4.
What is the molecular weight of Tribendilol?
The molecular weight of Tribendilol is 358.4 g/mol.
What is the IUPAC name of Tribendilol?
The IUPAC name of Tribendilol is 1-(2H-benzotriazol-4-yloxy)-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol.
What is the InChI of Tribendilol?
The InChI of Tribendilol is InChI=1S/C18H22N4O4/c1-24-15-6-2-3-7-16(15)25-10-9-19-11-13(23)12-26-17-8-4-5-14-18(17)21-22-20-14/h2-8,13,19,23H,9-12H2,1H3,(H,20,21,22).
What is the InChIKey of Tribendilol?
The InChIKey of Tribendilol is ZYRINAZRTBCAEE-UHFFFAOYSA-N.
What is the canonical SMILES of Tribendilol?
The canonical SMILES of Tribendilol is COC1=CC=CC=C1OCCNCC(COC2=CC=CC3=NNN=C32)O.
What is the CAS number of Tribendilol?
The CAS number of Tribendilol is 96258-13-8.
What is the UNII of Tribendilol?
The UNII of Tribendilol is K0744Q5ALP.
What is the ChEMBL ID of Tribendilol?
The ChEMBL ID of Tribendilol is CHEMBL2104914.
Is Tribendilol a canonicalized compound?
Yes, Tribendilol is a canonicalized compound.