What is the molecular formula of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The molecular formula of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is C6H4F6O2.
What is the molecular weight of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The molecular weight of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is 222.08 g/mol.
What is the IUPAC name of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The IUPAC name of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is 2,2,3,3,3-pentafluoropropyl 2-fluoroprop-2-enoate.
What is the canonical SMILES representation of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The canonical SMILES representation of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is C=C(C(=O)OCC(C(F)(F)F)(F)F)F.
What is the InChIKey of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The InChIKey of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is KOEWOWNPLYLJOW-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate have?
2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate has 8 hydrogen bond acceptor counts.
What is the topological polar surface area of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The topological polar surface area of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is 26.3 Ų.
How many defined atom stereocenter counts does 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate have?
2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate has 0 defined atom stereocenter counts.
Is 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate a canonicalized compound?
Yes, 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is a canonicalized compound.
What is the complexity value of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate?
The complexity value of 2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate is 243.