What is the PubChem CID of Eleutheroside E?
The PubChem CID of Eleutheroside E is 71312557.
What is the molecular formula of Eleutheroside E?
The molecular formula of Eleutheroside E is C34H46O18.
What are the synonyms of Eleutheroside E?
The synonyms of Eleutheroside E are Eleutheroside E, 39432-56-9, and UNII-8JP2P44H3Z.
What is the molecular weight of Eleutheroside E?
The molecular weight of Eleutheroside E is 742.7 g/mol.
What is the IUPAC name of Eleutheroside E?
The IUPAC name of Eleutheroside E is (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6R,6aS)-6-[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the InChI of Eleutheroside E?
The InChI of Eleutheroside E is InChI=1S/C34H46O18/c1-43-17-5-13(6-18(44-2)31(17)51-33-27(41)25(39)23(37)21(9-35)49-33)29-15-11-48-30(16(15)12-47-29)14-7-19(45-3)32(20(8-14)46-4)52-34-28(42)26(40)24(38)22(10-36)50-34/h5-8,15-16,21-30,33-42H,9-12H2,1-4H3/t15-,16+,21-,22-,23-,24-,25+,26+,27-,28-,29+,30-,33+,34+/m1/s1.
What is the InChIKey of Eleutheroside E?
The InChIKey of Eleutheroside E is FFDULTAFAQRACT-JSGUJALWSA-N.
What is the canonical SMILES of Eleutheroside E?
The canonical SMILES of Eleutheroside E is COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)OC6C(C(C(C(O6)CO)O)O)O)OC.
What is the CAS number of Eleutheroside E?
The CAS number of Eleutheroside E is 39432-56-9.