What is the molecular formula of 5-Nitrosalicylic acid?
The molecular formula of 5-Nitrosalicylic acid is C7H5NO5.
What is the molecular weight of 5-Nitrosalicylic acid?
The molecular weight of 5-Nitrosalicylic acid is 183.12 g/mol.
What is the IUPAC name of 5-Nitrosalicylic acid?
The IUPAC name of 5-Nitrosalicylic acid is 2-hydroxy-5-nitrobenzoic acid.
What is the InChI of 5-Nitrosalicylic acid?
The InChI of 5-Nitrosalicylic acid is InChI=1S/C7H5NO5/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,9H,(H,10,11).
What is the InChIKey of 5-Nitrosalicylic acid?
The InChIKey of 5-Nitrosalicylic acid is PPDRLQLKHRZIJC-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Nitrosalicylic acid?
The Canonical SMILES of 5-Nitrosalicylic acid is C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O).
What is the CAS number of 5-Nitrosalicylic acid?
The CAS number of 5-Nitrosalicylic acid is 96-97-9.
What is the European Community (EC) number of 5-Nitrosalicylic acid?
The European Community (EC) number of 5-Nitrosalicylic acid is 202-548-8.
What is the ChEMBL ID of 5-Nitrosalicylic acid?
The ChEMBL ID of 5-Nitrosalicylic acid is CHEMBL1940317.
What is the Monoisotopic Mass of 5-Nitrosalicylic acid?
The Monoisotopic Mass of 5-Nitrosalicylic acid is 183.01677226 g/mol.