What is the molecular formula of 2-Amino-5-nitrobenzenesulphonic acid?
The molecular formula of 2-Amino-5-nitrobenzenesulphonic acid is C6H6N2O5S.
What is the molecular weight of 2-Amino-5-nitrobenzenesulphonic acid?
The molecular weight of 2-Amino-5-nitrobenzenesulphonic acid is 218.19 g/mol.
What are the synonyms for 2-Amino-5-nitrobenzenesulphonic acid?
The synonyms for 2-Amino-5-nitrobenzenesulphonic acid include 2-Amino-5-nitrobenzenesulfonic acid, 96-75-3, 4-Nitro-2-sulfoaniline, 4-Nitroaniline-2-sulfonic acid, and Benzenesulfonic acid, 2-amino-5-nitro-.
What is the IUPAC name of 2-Amino-5-nitrobenzenesulphonic acid?
The IUPAC name of 2-Amino-5-nitrobenzenesulphonic acid is 2-amino-5-nitrobenzenesulfonic acid.
What is the InChI of 2-Amino-5-nitrobenzenesulphonic acid?
The InChI of 2-Amino-5-nitrobenzenesulphonic acid is InChI=1S/C6H6N2O5S/c7-5-2-1-4(8(9)10)3-6(5)14(11,12)13/h1-3H,7H2,(H,11,12,13).
What is the InChIKey of 2-Amino-5-nitrobenzenesulphonic acid?
The InChIKey of 2-Amino-5-nitrobenzenesulphonic acid is LTASFWDWBYFZQQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-5-nitrobenzenesulphonic acid?
The canonical SMILES of 2-Amino-5-nitrobenzenesulphonic acid is C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)O)N.
What is the CAS number of 2-Amino-5-nitrobenzenesulphonic acid?
The CAS number of 2-Amino-5-nitrobenzenesulphonic acid is 96-75-3.
What is the European Community (EC) number of 2-Amino-5-nitrobenzenesulphonic acid?
The European Community (EC) number of 2-Amino-5-nitrobenzenesulphonic acid is 202-531-5.
What is the molecular weight of 2-Amino-5-nitrobenzenesulphonic acid according to PubChem?
The molecular weight of 2-Amino-5-nitrobenzenesulphonic acid according to PubChem is 218.19 g/mol.
※ Please kindly note that our products are for research use only.