What is the molecular formula of 2-Amino-1-butanol?
The molecular formula of 2-Amino-1-butanol is C4H11NO.
What is the molecular weight of 2-Amino-1-butanol?
The molecular weight of 2-Amino-1-butanol is 89.14 g/mol.
What is the IUPAC name of 2-Amino-1-butanol?
The IUPAC name of 2-Amino-1-butanol is 2-aminobutan-1-ol.
What is the InChI of 2-Amino-1-butanol?
The InChI of 2-Amino-1-butanol is InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3.
What is the InChIKey of 2-Amino-1-butanol?
The InChIKey of 2-Amino-1-butanol is JCBPETKZIGVZRE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-1-butanol?
The canonical SMILES of 2-Amino-1-butanol is CCC(CO)N.
What is the CAS number of 2-Amino-1-butanol?
The CAS number of 2-Amino-1-butanol is 96-20-8.
What is the XLogP3-AA value of 2-Amino-1-butanol?
The XLogP3-AA value of 2-Amino-1-butanol is -0.4.
How many hydrogen bond donor counts does 2-Amino-1-butanol have?
2-Amino-1-butanol has 2 hydrogen bond donor counts.
How many rotatable bond counts does 2-Amino-1-butanol have?
2-Amino-1-butanol has 2 rotatable bond counts.