What is the PubChem CID for 1,2,3-tribromopropane?
The PubChem CID for 1,2,3-tribromopropane is 7279.
What is the molecular formula of 1,2,3-tribromopropane?
The molecular formula of 1,2,3-tribromopropane is C3H5Br3.
What is the molecular weight of 1,2,3-tribromopropane?
The molecular weight of 1,2,3-tribromopropane is 280.78 g/mol.
When was the compound created?
The compound was created on March 26, 2005.
What is the IUPAC name of 1,2,3-tribromopropane?
The IUPAC name of 1,2,3-tribromopropane is 1,2,3-tribromopropane.
What is the InChI of 1,2,3-tribromopropane?
The InChI of 1,2,3-tribromopropane is InChI=1S/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H2.
What is the InChIKey of 1,2,3-tribromopropane?
The InChIKey of 1,2,3-tribromopropane is FHCLGDLYRUPKAM-UHFFFAOYSA-N.
How many rotatable bonds does 1,2,3-tribromopropane have?
1,2,3-tribromopropane has 2 rotatable bonds.
What is the topological polar surface area of 1,2,3-tribromopropane?
The topological polar surface area of 1,2,3-tribromopropane is 0Ų.
What is the formal charge of 1,2,3-tribromopropane?
The formal charge of 1,2,3-tribromopropane is 0.