What is the molecular formula of Diiodoacetonitrile?
The molecular formula of Diiodoacetonitrile is C2HI2N.
What is the molecular weight of Diiodoacetonitrile?
The molecular weight of Diiodoacetonitrile is 292.84 g/mol.
When was Diiodoacetonitrile created?
Diiodoacetonitrile was created on May 17, 2013.
What is the IUPAC name of Diiodoacetonitrile?
The IUPAC name of Diiodoacetonitrile is 2,2-diiodoacetonitrile.
What is the InChI of Diiodoacetonitrile?
The InChI of Diiodoacetonitrile is InChI=1S/C2HI2N/c3-2(4)1-5/h2H.
What is the InChIKey of Diiodoacetonitrile?
The InChIKey of Diiodoacetonitrile is KYQFQQBHGKPDHL-UHFFFAOYSA-N.
What is the canonical SMILES of Diiodoacetonitrile?
The canonical SMILES of Diiodoacetonitrile is C(#N)C(I)I.
What is the CAS number of Diiodoacetonitrile?
The CAS number of Diiodoacetonitrile is 959961-04-7.
What is the XLogP3-AA value of Diiodoacetonitrile?
The XLogP3-AA value of Diiodoacetonitrile is 1.4.
Is Diiodoacetonitrile a canonicalized compound?
Yes, Diiodoacetonitrile is a canonicalized compound according to PubChem.
Download
