What is the molecular formula of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The molecular formula is C25H20F3NO4.
What is the molecular weight of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The molecular weight is 455.4 g/mol.
What is the IUPAC name of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The IUPAC name is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)butanoic acid.
What is the InChI of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The InChI is InChI=1S/C25H20F3NO4/c26-21-12-23(28)22(27)10-14(21)9-15(11-24(30)31)29-25(32)33-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,10,12,15,20H,9,11,13H2,(H,29,32)(H,30,31)/t15-/m0/s1.
How many hydrogen bond donor counts does Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid have?
Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The XLogP3-AA value is 4.9.
How many hydrogen bond acceptor counts does Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid have?
It has 7 hydrogen bond acceptor counts.
What is the topological polar surface area of Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid?
The topological polar surface area is 75.6 Ų.
How many rotatable bond counts does Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid have?
It has 8 rotatable bond counts.
Is Fmoc-(S)-3-amino-4-(2,4,5-trifluorophenyl)-butyric acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.