What is the molecular formula of 2-Iodopropane-2-d1?
The molecular formula of 2-Iodopropane-2-d1 is C3H7I.
What is the molecular weight of 2-Iodopropane-2-d1?
The molecular weight of 2-Iodopropane-2-d1 is 171.00 g/mol.
What is the IUPAC name of 2-Iodopropane-2-d1?
The IUPAC name of 2-Iodopropane-2-d1 is 2-deuterio-2-iodopropane.
What is the InChI of 2-Iodopropane-2-d1?
The InChI of 2-Iodopropane-2-d1 is InChI=1S/C3H7I/c1-3(2)4/h3H,1-2H3/i3D.
What is the InChIKey of 2-Iodopropane-2-d1?
The InChIKey of 2-Iodopropane-2-d1 is FMKOJHQHASLBPH-WFVSFCRTSA-N.
What is the canonical SMILES of 2-Iodopropane-2-d1?
The canonical SMILES of 2-Iodopropane-2-d1 is CC(C)I.
What is the isomeric SMILES of 2-Iodopropane-2-d1?
The isomeric SMILES of 2-Iodopropane-2-d1 is [2H]C(C)(C)I.
What is the xLogP3-AA value of 2-Iodopropane-2-d1?
The xLogP3-AA value of 2-Iodopropane-2-d1 is 2.3.
What is the hydrogen bond donor count of 2-Iodopropane-2-d1?
The hydrogen bond donor count of 2-Iodopropane-2-d1 is 0.
What is the hydrogen bond acceptor count of 2-Iodopropane-2-d1?
The hydrogen bond acceptor count of 2-Iodopropane-2-d1 is 0.