What is the molecular formula of the compound referenced?
The molecular formula of the compound referenced is C11H16OSi.
What are the synonyms of the compound referenced?
The synonyms of the compound referenced are 1-Dimethylvinylsilyloxy-3-methylbenzene, BENZENE, 1-[(ETHENYLDIMETHYLSILYL)OXY]-3-METHYL-, DTXSID60336357, KHHKJMKTAPOXKM-UHFFFAOYSA-N.
What is the molecular weight of the compound referenced?
The molecular weight of the compound referenced is 192.33 g/mol.
What is the IUPAC name of the compound referenced?
The IUPAC name of the compound referenced is ethenyl-dimethyl-(3-methylphenoxy)silane.
What is the InChI of the compound referenced?
The InChI of the compound referenced is InChI=1S/C11H16OSi/c1-5-13(3,4)12-11-8-6-7-10(2)9-11/h5-9H,1H2,2-4H3.
What is the InChIKey of the compound referenced?
The InChIKey of the compound referenced is KHHKJMKTAPOXKM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound referenced?
The canonical SMILES of the compound referenced is CC1=CC(=CC=C1)O[Si](C)(C)C=C.
What is the CAS number of the compound referenced?
The CAS number of the compound referenced is 959251-36-6.
How many hydrogen bond donor counts does the compound referenced have?
The compound referenced has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound referenced have?
The compound referenced has 1 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.