The molecular formula of the compound is C7H10ClN3O.
Are there any synonyms for the compound?
Yes, the compound has synonyms such as 959016-31-0, ACETAMIDE,N-[2-(5-CHLORO-1H-IMIDAZOL-4-YL)ETHYL]-, Histamine, N-acetyl-5-chloro-, and N-[2-(5-Chloro-1H-imidazol-4-yl)ethyl]acetamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 187.63 g/mol.
When was the compound created and last modified?
The compound was created on March 27, 2005, and last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-[2-(4-chloro-1H-imidazol-5-yl)ethyl]acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H10ClN3O/c1-5(12)9-3-2-6-7(8)11-4-10-6/h4H,2-3H2,1H3,(H,9,12)(H,10,11).
What is the InChIKey of the compound?
The InChIKey of the compound is JZNUYVYWGHWLIL-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=O)NCCC1=C(N=CN1)Cl.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.6.
※ Please kindly note that our products are for research use only.