What is the PubChem CID of 5,12-Dihydrotetracene?
The PubChem CID of 5,12-Dihydrotetracene is 96862.
What is the molecular formula of 5,12-Dihydrotetracene?
The molecular formula of 5,12-Dihydrotetracene is C18H14.
What is the molecular weight of 5,12-Dihydrotetracene?
The molecular weight of 5,12-Dihydrotetracene is 230.3 g/mol.
What is the IUPAC name of 5,12-Dihydrotetracene?
The IUPAC name of 5,12-Dihydrotetracene is 5,12-dihydrotetracene.
What is the InChI of 5,12-Dihydrotetracene?
The InChI of 5,12-Dihydrotetracene is InChI=1S/C18H14/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-10H,11-12H2.
What is the InChIKey of 5,12-Dihydrotetracene?
The InChIKey of 5,12-Dihydrotetracene is WSXODQAKLVVOCS-UHFFFAOYSA-N.
What is the canonical SMILES of 5,12-Dihydrotetracene?
The canonical SMILES of 5,12-Dihydrotetracene is C1C2=CC=CC=C2CC3=CC4=CC=CC=C4C=C31.
What is the CAS number of 5,12-Dihydrotetracene?
The CAS number of 5,12-Dihydrotetracene is 959-02-4.
What is the European Community (EC) Number of 5,12-Dihydrotetracene?
The European Community (EC) Number of 5,12-Dihydrotetracene is 213-491-3.
Is 5,12-Dihydrotetracene a canonicalized compound?
Yes, 5,12-Dihydrotetracene is a canonicalized compound.