What is the molecular formula of 3-Methylthymidine?
The molecular formula of 3-Methylthymidine is C11H16N2O5.
What is the molecular weight of 3-Methylthymidine?
The molecular weight of 3-Methylthymidine is 256.25 g/mol.
What is the IUPAC name of 3-Methylthymidine?
The IUPAC name of 3-Methylthymidine is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione.
What is the InChI of 3-Methylthymidine?
The InChI of 3-Methylthymidine is InChI=1S/C11H16N2O5/c1-6-4-13(11(17)12(2)10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,3,5H2,1-2H3/t7-,8+,9+/m0/s1.
What is the InChIKey of 3-Methylthymidine?
The InChIKey of 3-Methylthymidine is JCVDICFLPGDHAT-DJLDLDEBSA-N.
What is the canonical SMILES of 3-Methylthymidine?
The canonical SMILES of 3-Methylthymidine is CC1=CN(C(=O)N(C1=O)C)C2CC(C(O2)CO)O.
What is the XLogP3 value of 3-Methylthymidine?
The XLogP3 value of 3-Methylthymidine is -1.
How many hydrogen bond donor counts are there in 3-Methylthymidine?
There are 2 hydrogen bond donor counts in 3-Methylthymidine.
How many hydrogen bond acceptor counts are there in 3-Methylthymidine?
There are 5 hydrogen bond acceptor counts in 3-Methylthymidine.