What is the molecular formula of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The molecular formula is C7H5BBrFO4.
What are the synonyms of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The synonyms include 957120-63-7, 3-borono-5-bromo-2-fluorobenzoic acid, 2-Fluoro-3-carboxy-5-bromophenylboronic acid, and 3-borono-5-bromo-2-fluoro-benzoic acid.
What is the molecular weight of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The molecular weight is 262.83 g/mol.
What is the IUPAC name of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The IUPAC name is 3-borono-5-bromo-2-fluorobenzoic acid.
What is the InChI of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The InChI is InChI=1S/C7H5BBrFO4/c9-3-1-4(7(11)12)6(10)5(2-3)8(13)14/h1-2,13-14H,(H,11,12).
What is the InChIKey of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The InChIKey is RFODFEHCGMALLT-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1F)C(=O)O)Br)(O)O.
What is the CAS number of 5-Bromo-3-carboxy-2-fluorophenylboronic acid?
The CAS number is 957120-63-7.
Is 5-Bromo-3-carboxy-2-fluorophenylboronic acid a canonicalized compound?
Yes, 5-Bromo-3-carboxy-2-fluorophenylboronic acid is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.