What is the molecular formula of Cefprozil anhydrous?
The molecular formula of Cefprozil anhydrous is C18H19N3O5S.
What is the molecular weight of Cefprozil anhydrous?
The molecular weight of Cefprozil anhydrous is 389.4 g/mol.
What are the synonyms for Cefprozil anhydrous?
The synonyms for Cefprozil anhydrous are cefprozil, Cefprozilum, and Cefzil.
What is the IUPAC name of Cefprozil anhydrous?
The IUPAC name of Cefprozil anhydrous is (6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
What is the InChI of Cefprozil anhydrous?
The InChI of Cefprozil anhydrous is InChI=1S/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/b3-2+/t12-,13-,17-/m1/s1.
What is the InChIKey of Cefprozil anhydrous?
The InChIKey of Cefprozil anhydrous is WDLWHQDACQUCJR-ZAMMOSSLSA-N.
What is the canonical SMILES of Cefprozil anhydrous?
The canonical SMILES of Cefprozil anhydrous is CC=CC1=C(N2C(C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)SC1)C(=O)O.
What is the isomeric SMILES of Cefprozil anhydrous?
The isomeric SMILES of Cefprozil anhydrous is C/C=C/C1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)SC1)C(=O)O.
What is the CAS number of Cefprozil anhydrous?
The CAS number of Cefprozil anhydrous is 92665-29-7.
What is the ChEMBL ID of Cefprozil anhydrous?
The ChEMBL ID of Cefprozil anhydrous is CHEMBL276568.