What is the molecular formula of 6-Ethyl-4H-chromen-4-one?
The molecular formula of 6-Ethyl-4H-chromen-4-one is C11H10O2.
What is the molecular weight of 6-Ethyl-4H-chromen-4-one?
The molecular weight of 6-Ethyl-4H-chromen-4-one is 174.20 g/mol.
What is the IUPAC name of 6-Ethyl-4H-chromen-4-one?
The IUPAC name of 6-Ethyl-4H-chromen-4-one is 6-ethylchromen-4-one.
What is the InChI of 6-Ethyl-4H-chromen-4-one?
The InChI of 6-Ethyl-4H-chromen-4-one is InChI=1S/C11H10O2/c1-2-8-3-4-11-9(7-8)10(12)5-6-13-11/h3-7H,2H2,1H3.
What is the InChIKey of 6-Ethyl-4H-chromen-4-one?
The InChIKey of 6-Ethyl-4H-chromen-4-one is BTFKSYQTYZVFFF-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Ethyl-4H-chromen-4-one?
The canonical SMILES of 6-Ethyl-4H-chromen-4-one is CCC1=CC2=C(C=C1)OC=CC2=O.
What is the CAS number of 6-Ethyl-4H-chromen-4-one?
The CAS number of 6-Ethyl-4H-chromen-4-one is 95639-21-7.
How many hydrogen bond donor counts does 6-Ethyl-4H-chromen-4-one have?
6-Ethyl-4H-chromen-4-one has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Ethyl-4H-chromen-4-one have?
6-Ethyl-4H-chromen-4-one has 2 hydrogen bond acceptor counts.