What is the molecular formula of 6-Benzamido-hexanoic acid?
The molecular formula of 6-Benzamido-hexanoic acid is C13H17NO3.
What is the molecular weight of 6-Benzamido-hexanoic acid?
The molecular weight of 6-Benzamido-hexanoic acid is 235.28 g/mol.
What is the IUPAC name of 6-Benzamido-hexanoic acid?
The IUPAC name of 6-Benzamido-hexanoic acid is 6-benzamidohexanoic acid.
What is the InChI of 6-Benzamido-hexanoic acid?
The InChI of 6-Benzamido-hexanoic acid is InChI=1S/C13H17NO3/c15-12(16)9-5-2-6-10-14-13(17)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,17)(H,15,16).
What is the InChIKey of 6-Benzamido-hexanoic acid?
The InChIKey of 6-Benzamido-hexanoic acid is LFCIOBCYMAQQBT-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Benzamido-hexanoic acid?
The canonical SMILES of 6-Benzamido-hexanoic acid is C1=CC=C(C=C1)C(=O)NCCCCCC(=O)O.
What is the CAS number of 6-Benzamido-hexanoic acid?
The CAS number of 6-Benzamido-hexanoic acid is 956-09-2.
What is the XLogP3 value of 6-Benzamido-hexanoic acid?
The XLogP3 value of 6-Benzamido-hexanoic acid is 1.4.
How many hydrogen bond donor counts does 6-Benzamido-hexanoic acid have?
6-Benzamido-hexanoic acid has 2 hydrogen bond donor counts.
※ Please kindly note that our products are for research use only.